CAS 52414-99-0 is the registry number for 3-Iodo-2-nitro toluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-iodo-3-methyl-2-nitrobenzene (CAS 52414-99-0) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-3-methyl-2-nitrobenzene. InChIKey: YUHQOZRCAFHTGP-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-3-methyl-2-nitrobenzene |
| InChIKey | YUHQOZRCAFHTGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)