Products 5326-39-6
CAS 5326-39-6 appears in our catalog under these names: 4-Iodo-3-nitrotoluene, 97%, 4–Iodo–3–nitrotoluene, 4-Iodo-3-nitrotoluene, 4-Iodo-3-nitrotoluene, >98.0%(GC), 1-Iodo-4-methyl-2-nitrobenzene 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 5g, 500g, 25g, 50g, 1g, 250g, 10g.
1-iodo-4-methyl-2-nitrobenzene (CAS 5326-39-6) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-4-methyl-2-nitrobenzene. InChIKey: DKYCDXAZCHMPSJ-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-4-methyl-2-nitrobenzene |
| InChIKey | DKYCDXAZCHMPSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)