cas: 2113-51-1 — see every product listed under this CAS number, including other names
2-Iodobiphenyl 98% (CAS 2113-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273054-1000g |
| cas | 2113-51-1 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4909.38 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 242.44 Pln | |
| Ambeed | 100g | 698.56 Pln | |
| Ambeed | 500g | 3090.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A273054 |
1-iodo-2-phenylbenzene (CAS 2113-51-1) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-2-phenylbenzene. InChIKey: QFUYDAGNUJWBSM-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-2-phenylbenzene |
| InChIKey | QFUYDAGNUJWBSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2I |
Computed by PubChem (NCBI)