CAS 1591-31-7 appears in our catalog under these names: 4–Iodobiphenyl, 4-Iodobiphenyl, 97% , 4-Iodobiphenyl, 4-Iodobiphenyl, 97+%, 4-Iodobiphenyl, >97.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 500g, 1g, 5g, 25g, 10g, 50g, 1000g.
1-iodo-4-phenylbenzene (CAS 1591-31-7) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-4-phenylbenzene. InChIKey: NXYICUMSYKIABQ-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-4-phenylbenzene |
| InChIKey | NXYICUMSYKIABQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)