CAS 2113-51-1 appears in our catalog under these names: 2–Iodobiphenyl, 2-Iodobiphenyl, 98% , 2-Iodobiphenyl, 98%, 2-Iodobiphenyl, >98.0%(GC), 2-Iodobiphenyl 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 10g, 500g, 250g.
1-iodo-2-phenylbenzene (CAS 2113-51-1) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-2-phenylbenzene. InChIKey: QFUYDAGNUJWBSM-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-2-phenylbenzene |
| InChIKey | QFUYDAGNUJWBSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2I |
Computed by PubChem (NCBI)