2-Isopropoxy-4-trifluoromethylphenylboronic acid, 98%, 98%
cas: 1072952-21-6 — see every product listed under this CAS number, including other names
2-Isopropoxy-4-trifluoromethylphenylboronic acid, 98%, 98% (CAS 1072952-21-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WI9-250mg |
| cas | 1072952-21-6 |
| size | 250mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 10g | 1149.20 Pln | |
| Chemat | 25g | 2234.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1072952-21-6) is a chemical compound with the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. IUPAC name: [2-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: IGJULKZGKYXWAR-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [2-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | IGJULKZGKYXWAR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Isopropoxy-4-(trifluoromethyl)phenyl)boronic acid, [2-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid, [2-Isopropoxy-4-(trifluoromethyl)phenyl]boronic acid, (2-Isopropoxy-4-(trifluoromethyl)-phenyl)boronic acid, 2-isopropoxy-4-(trifluoromethyl)phenylboronicacid, {2-[(Propan-2-yl)oxy]-4-(trifluoromethyl)phenyl}boronic acid