2-Isopropylisoindoline-1,3-dione, 97%
cas: 304-17-6 — see every product listed under this CAS number, including other names
2-Isopropylisoindoline-1,3-dione, 97% (CAS 304-17-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114118-250mg |
| cas | 304-17-6 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 50g | 602.00 Pln | |
| Chemat | 100g | 1077.20 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 25g | 553.16 Pln | |
| BLDpharm | 100g | 1697.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-propan-2-ylisoindole-1,3-dione (CAS 304-17-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-propan-2-ylisoindole-1,3-dione. InChIKey: VPLDXHDOGVIETL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-propan-2-ylisoindole-1,3-dione |
| InChIKey | VPLDXHDOGVIETL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)