2-METHYLPYRIDINE-4-SULFONYL CHLORIDE, 95%
cas: 1025509-77-6 — see every product listed under this CAS number, including other names
2-METHYLPYRIDINE-4-SULFONYL CHLORIDE, 95% (CAS 1025509-77-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F847345-50MG |
| cas | 1025509-77-6 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 476.93 Pln | |
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 955.93 Pln | |
| Fluorochem | 1g | 2325.24 Pln | |
| Fluorochem | 5g | 7729.59 Pln | |
| Ambeed | 100mg | 642.94 Pln | |
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 2261.62 Pln | |
| Ambeed | 5g | 7701.75 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-methylpyridine-4-sulfonyl chloride (CAS 1025509-77-6) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 2-methylpyridine-4-sulfonyl chloride. InChIKey: YEVNZFBCVWXEBS-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 2-methylpyridine-4-sulfonyl chloride |
| InChIKey | YEVNZFBCVWXEBS-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)