CAS 338401-79-9 is the registry number for 3-Ethyl-2-mercaptothieno[3,2-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-ethyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (CAS 338401-79-9) is a chemical compound with the molecular formula C8H8N2OS2 and a molecular weight of 212.3 g/mol. IUPAC name: 3-ethyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one. InChIKey: QQPGLIIOMJKXPS-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 3-ethyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | QQPGLIIOMJKXPS-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(C=CS2)NC1=S |
Computed by PubChem (NCBI)