CAS 215778-71-5 is the registry number for N-(2,5-thiazolinyl)-2-thienylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4,5-dihydro-1,3-thiazol-2-yl)thiophene-2-carboxamide (CAS 215778-71-5) is a chemical compound with the molecular formula C8H8N2OS2 and a molecular weight of 212.3 g/mol. IUPAC name: N-(4,5-dihydro-1,3-thiazol-2-yl)thiophene-2-carboxamide. InChIKey: OUGRZEREDSEDGA-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | N-(4,5-dihydro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| InChIKey | OUGRZEREDSEDGA-UHFFFAOYSA-N |
| SMILES | C1CSC(=N1)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)