CAS 51486-14-7 is the registry number for 3,5-Dimethyl-2-sulfanyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3,5-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 51486-14-7) is a chemical compound with the molecular formula C8H8N2OS2 and a molecular weight of 212.3 g/mol. IUPAC name: 3,5-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: ZYSMOJFPRPGPRU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 3,5-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | ZYSMOJFPRPGPRU-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1C(=O)N(C(=S)N2)C |
Computed by PubChem (NCBI)