cas: 55317-02-7 — see every product listed under this CAS number, including other names
2-Methoxy-1-(2,4,6-trihydroxyphenyl)ethanone, 95%, 95% (CAS 55317-02-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBQL-250mg |
| cas | 55317-02-7 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 1g | 2397.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-1-(2,4,6-trihydroxyphenyl)ethanone (CAS 55317-02-7) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-methoxy-1-(2,4,6-trihydroxyphenyl)ethanone. InChIKey: FYRXXSCCOWRCLX-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-methoxy-1-(2,4,6-trihydroxyphenyl)ethanone |
| InChIKey | FYRXXSCCOWRCLX-UHFFFAOYSA-N |
| SMILES | COCC(=O)C1=C(C=C(C=C1O)O)O |
Computed by PubChem (NCBI)