cas: 33623-16-4 — see every product listed under this CAS number, including other names
2-Methoxy-3-nitropyridin-4-amine 98% (CAS 33623-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233551-100mg |
| cas | 33623-16-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2428.50 Pln | |
| Ambeed | 10g | 3841.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A233551 |
2-methoxy-3-nitropyridin-4-amine (CAS 33623-16-4) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 2-methoxy-3-nitropyridin-4-amine. InChIKey: XADFTCGTAKIZMI-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 2-methoxy-3-nitropyridin-4-amine |
| InChIKey | XADFTCGTAKIZMI-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)