cas: 18102-29-9 — see every product listed under this CAS number, including other names
2-Methoxy-3-nitrotoluene, 97% (CAS 18102-29-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038811-1G |
| cas | 18102-29-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1060.06 Pln | |
| Fluorochem | 100g | 4048.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-methoxy-1-methyl-3-nitrobenzene (CAS 18102-29-9) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-methoxy-1-methyl-3-nitrobenzene. InChIKey: OCSBJPCSPDPAQL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-methoxy-1-methyl-3-nitrobenzene |
| InChIKey | OCSBJPCSPDPAQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)