Products 18102-29-9
CAS 18102-29-9 appears in our catalog under these names: 2-Methyl-6-nitroanisole, 98%, 2-Methoxy-1-methyl-3-nitrobenzene, 97%, 2–Methyl–6–nitroanisole, 2-Methyl-6-nitroanisole, 97%, 97%, 2-Methoxy-3-nitrotoluene, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g.
2-methoxy-1-methyl-3-nitrobenzene (CAS 18102-29-9) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-methoxy-1-methyl-3-nitrobenzene. InChIKey: OCSBJPCSPDPAQL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-methoxy-1-methyl-3-nitrobenzene |
| InChIKey | OCSBJPCSPDPAQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)