cas: 1027888-79-4 — see every product listed under this CAS number, including other names
2-Methoxy-4-(trifluoromethyl)phenol, 97%, 97% (CAS 1027888-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H0V1-100mg |
| cas | 1027888-79-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 971.60 Pln | |
| Chemat | 5g | 2795.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-4-(trifluoromethyl)phenol (CAS 1027888-79-4) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)phenol. InChIKey: WULGVCJGJHHILR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)phenol |
| InChIKey | WULGVCJGJHHILR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)