cas: 190774-55-1 — see every product listed under this CAS number, including other names
2-Methoxy-4-nitrophenyl isothiocyanate, 98% (CAS 190774-55-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009510-1G |
| cas | 190774-55-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 565.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-isothiocyanato-2-methoxy-4-nitrobenzene (CAS 190774-55-1) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 1-isothiocyanato-2-methoxy-4-nitrobenzene. InChIKey: NXWXXLFRMVILJN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 1-isothiocyanato-2-methoxy-4-nitrobenzene |
| InChIKey | NXWXXLFRMVILJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])N=C=S |
Computed by PubChem (NCBI)