CAS 71793-51-6 is the registry number for 2-Methoxy-5-nitrophenyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-isothiocyanato-1-methoxy-4-nitrobenzene (CAS 71793-51-6) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 2-isothiocyanato-1-methoxy-4-nitrobenzene. InChIKey: QVOHAYVRNBCJDV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 2-isothiocyanato-1-methoxy-4-nitrobenzene |
| InChIKey | QVOHAYVRNBCJDV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N=C=S |
Computed by PubChem (NCBI)