CAS 368870-05-7 appears in our catalog under these names: 5-(2-Methyl-1,3-thiazol-4-yl)-3-isoxazolecarboxylic acid, 95%, 5-(2-Methylthiazol-4-yl)isoxazole-3-carboxylic acid, 97%, 5-(2-Methyl-1,3-thiazol-4-yl)-3-isoxazolecarboxylic acid, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 250mg, 1g, 100mg.
5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 368870-05-7) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: QAXQRHWAJNDTCV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | QAXQRHWAJNDTCV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)