CAS 21762-75-4 is the registry number for 7-Nitro-2H-1,4-benzothiazin-3(4H)-one, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
7-nitro-4H-1,4-benzothiazin-3-one (CAS 21762-75-4) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 7-nitro-4H-1,4-benzothiazin-3-one. InChIKey: OOICZQBVVODNDJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 7-nitro-4H-1,4-benzothiazin-3-one |
| InChIKey | OOICZQBVVODNDJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)