cas: 1312765-17-5 — see every product listed under this CAS number, including other names
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 95+%, 95+% (CAS 1312765-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AAGC-100mg |
| cas | 1312765-17-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 5262.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1312765-17-5) is a chemical compound with the molecular formula C10H16BNO3S and a molecular weight of 241.12 g/mol. IUPAC name: 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: NNPOTMMCXYMAPM-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3S |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | NNPOTMMCXYMAPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)OC |
Computed by PubChem (NCBI)