CAS 2446486-79-7 is the registry number for 3-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isothiazole, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole (CAS 2446486-79-7) is a chemical compound with the molecular formula C10H16BNO3S and a molecular weight of 241.12 g/mol. IUPAC name: 3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole. InChIKey: DMBZPRGQYBOKMG-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3S |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole |
| InChIKey | DMBZPRGQYBOKMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSN=C2OC |
Computed by PubChem (NCBI)