CAS 1970977-61-7 is the registry number for (2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiazol-5-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-5-yl]methanol (CAS 1970977-61-7) is a chemical compound with the molecular formula C10H16BNO3S and a molecular weight of 241.12 g/mol. IUPAC name: [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-5-yl]methanol. InChIKey: QMWHAGRUAODFFL-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3S |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-5-yl]methanol |
| InChIKey | QMWHAGRUAODFFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=C(S2)CO |
Computed by PubChem (NCBI)