CAS 1312765-17-5 appears in our catalog under these names: 2-Methoxythiazole-5-boronic acid pinacol ester, 95%, 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 95+%, 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1312765-17-5) is a chemical compound with the molecular formula C10H16BNO3S and a molecular weight of 241.12 g/mol. IUPAC name: 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: NNPOTMMCXYMAPM-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3S |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | NNPOTMMCXYMAPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)OC |
Computed by PubChem (NCBI)