cas: 34636-92-5 — see every product listed under this CAS number, including other names
2-Methoxy-5-(trifluoromethyl)benzonitrile 98% (CAS 34636-92-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A903414-1g |
| cas | 34636-92-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 314.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A903414 |
2-methoxy-5-(trifluoromethyl)benzonitrile (CAS 34636-92-5) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)benzonitrile. InChIKey: KAJZODLWVHKBSI-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)benzonitrile |
| InChIKey | KAJZODLWVHKBSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)