CAS 34636-92-5 appears in our catalog under these names: 2–Methoxy–5–(trifluoromethyl)benzonitrile, 2-Methoxy-5-(trifluoromethyl)benzonitrile, 97%, 2-Methoxy-5-(trifluoromethyl)benzonitrile 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g.
2-methoxy-5-(trifluoromethyl)benzonitrile (CAS 34636-92-5) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)benzonitrile. InChIKey: KAJZODLWVHKBSI-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)benzonitrile |
| InChIKey | KAJZODLWVHKBSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)