CAS 51903-64-1 is the registry number for 4-Methyl-3-(trifluoromethyl)phenylisocyanate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
4-isocyanato-1-methyl-2-(trifluoromethyl)benzene (CAS 51903-64-1) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 4-isocyanato-1-methyl-2-(trifluoromethyl)benzene. InChIKey: XWSZWQGFJRBXMO-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 4-isocyanato-1-methyl-2-(trifluoromethyl)benzene |
| InChIKey | XWSZWQGFJRBXMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=C=O)C(F)(F)F |
Computed by PubChem (NCBI)