CAS 868167-61-7 appears in our catalog under these names: 3-Methoxy-5-(trifluoromethyl)benzonitrile, 98%, 3-Methoxy-5-(trifluoromethyl)benzonitrile, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 50g.
3-methoxy-5-(trifluoromethyl)benzonitrile (CAS 868167-61-7) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 3-methoxy-5-(trifluoromethyl)benzonitrile. InChIKey: DSMSXBUFGYTQPM-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 3-methoxy-5-(trifluoromethyl)benzonitrile |
| InChIKey | DSMSXBUFGYTQPM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)