2-Methoxy-5-(trifluoromethyl)phenol 98%
cas: 349-67-7 — see every product listed under this CAS number, including other names
2-Methoxy-5-(trifluoromethyl)phenol 98% (CAS 349-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A627790-100mg |
| cas | 349-67-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1610.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A627790 |
2-methoxy-5-(trifluoromethyl)phenol (CAS 349-67-7) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)phenol. InChIKey: CHTWPKLLBRDFNP-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)phenol |
| InChIKey | CHTWPKLLBRDFNP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)