cas: 99-59-2 — see every product listed under this CAS number, including other names
2-Methoxy-5-nitroaniline 98% (CAS 99-59-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A944741-5g |
| cas | 99-59-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 648.50 Pln | |
| Ambeed | 500g | 2940.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A944741 |
2-methoxy-5-nitroaniline is a substituted aniline and a member of 4-nitroanisoles.
Source: ChEBI
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-5-nitroaniline |
| InChIKey | NIPDVSLAMPAWTP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)