cas: 881-03-8 — see every product listed under this CAS number, including other names
2-Methyl-1-nitronaphthalene, 97% (CAS 881-03-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069103-5G |
| cas | 881-03-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 383.22 Pln | |
| Fluorochem | 100g | 1263.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-methyl-1-nitronaphthalene (CAS 881-03-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-methyl-1-nitronaphthalene. InChIKey: IZNWACYOILBFEG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-methyl-1-nitronaphthalene |
| InChIKey | IZNWACYOILBFEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)