cas: 138564-60-0 — see every product listed under this CAS number, including other names
2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride, 95%, 95% (CAS 138564-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVB2-1g |
| cas | 138564-60-0 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 755.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride (CAS 138564-60-0) is a chemical compound with the molecular formula C12H12ClN3S and a molecular weight of 265.76 g/mol. IUPAC name: 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride. InChIKey: FDWMAKNNNPSUTL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3S |
|---|---|
| Molecular weight | 265.76 g/mol |
| IUPAC name | 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride |
| InChIKey | FDWMAKNNNPSUTL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)