Olanzapine HCl-Bio-X 95%
cas: 138564-60-0 — see every product listed under this CAS number, including other names
Olanzapine HCl-Bio-X 95% (CAS 138564-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166566-1g |
| cas | 138564-60-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 576.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A166566 |
2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride (CAS 138564-60-0) is a chemical compound with the molecular formula C12H12ClN3S and a molecular weight of 265.76 g/mol. IUPAC name: 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride. InChIKey: FDWMAKNNNPSUTL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3S |
|---|---|
| Molecular weight | 265.76 g/mol |
| IUPAC name | 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride |
| InChIKey | FDWMAKNNNPSUTL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride, 4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride, 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride, 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine hydrochloride, C12H12ClN3S, Olanzamine hydrochloride, 10H-Thieno[2,3-b][1,5]benzodiazepin-4-amine, 2-methyl-,monohydrochloride, 2-methyl-10H-benzo[b]thiopheno[3,2-f]1,4-diazepine-4-ylamine, chloride, 4-amino-2-methyl-10h-thieno[2,3-b][1,5]-benzodiazepine hydrochloride, 2-methyl-5H-thieno[3,2-c][1,5]benzodiazepin-4-amine