cas: 946497-95-6 — see every product listed under this CAS number, including other names
2-Methyl-2-propanyl 3'-amino-1',4'-dihydro-5'H-spiro[cyclopropane-1,6'-pyrrolo[3,4-c]pyrazole]-5'-carboxylate, 95%, 95% (CAS 946497-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140D8-100mg |
| cas | 946497-95-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate (CAS 946497-95-6) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate. InChIKey: GEEYXEHYZYEWAT-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate |
| InChIKey | GEEYXEHYZYEWAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C13CC3)NN=C2N |
Computed by PubChem (NCBI)