cas: 946497-95-6 — see every product listed under this CAS number, including other names
3'-Amino-5'-Boc-1',4'-dihydrospiro(cyclopropane-1,6'(5'H)-pyrrolo(3,4-c)pyrazole), 98% (CAS 946497-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A222501-1g |
| cas | 946497-95-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8109.85 Pln | |
| AmBeed | 5g | 23317.21 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate (CAS 946497-95-6) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate. InChIKey: GEEYXEHYZYEWAT-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | tert-butyl 3-aminospiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxylate |
| InChIKey | GEEYXEHYZYEWAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C13CC3)NN=C2N |
Computed by PubChem (NCBI)