cas: 957034-45-6 — see every product listed under this CAS number, including other names
2-Methyl-4-(trifluoromethyl)phenylboronic acid 96% (CAS 957034-45-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A373468-250mg |
| cas | 957034-45-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 815.38 Pln | |
| Ambeed | 25g | 3318.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A373468 |
[2-methyl-4-(trifluoromethyl)phenyl]boronic acid (CAS 957034-45-6) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-methyl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: USEHFBIGOATLIA-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-methyl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | USEHFBIGOATLIA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)