cas: 957034-45-6 — see every product listed under this CAS number, including other names
2-Methyl-4-(trifluoromethyl)phenylboronic acid, 97% (CAS 957034-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219431-1G |
| cas | 957034-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 10g | 1528.65 Pln | |
| Fluorochem | 25g | 3319.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-methyl-4-(trifluoromethyl)phenyl]boronic acid (CAS 957034-45-6) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-methyl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: USEHFBIGOATLIA-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-methyl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | USEHFBIGOATLIA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)