cas: 1052686-67-5 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 97%, 97% (CAS 1052686-67-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144EH-100mg |
| cas | 1052686-67-5 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 100g | 2382.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1052686-67-5) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: COBZMDPXIDGRHY-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | COBZMDPXIDGRHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C |
Computed by PubChem (NCBI)