cas: 876922-75-7 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 98% (CAS 876922-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496848-100MG |
| cas | 876922-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 1356.83 Pln | |
| Fluorochem | 5g | 6558.13 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 876922-75-7) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: VYJMNRHPDWSKAJ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | VYJMNRHPDWSKAJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC(=NC3=CC=C2)C |
Computed by PubChem (NCBI)