CAS 2096334-29-9 is the registry number for 6-Methylquinoline-8-boronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
6-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2096334-29-9) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 6-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: NXQVVZIFHBEJKK-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 6-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | NXQVVZIFHBEJKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2N=CC=C3)C |
Computed by PubChem (NCBI)