Products 2223039-40-3
CAS 2223039-40-3 is the registry number for 5-Cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2223039-40-3) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 5-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: DSYKJDCTVHQYHM-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 5-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | DSYKJDCTVHQYHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3CC3)C#N |
Computed by PubChem (NCBI)