CAS 1310403-85-0 is the registry number for 1-Phenylpyrrole-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1310403-85-0) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: VNVCVJBYXTXQRQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | VNVCVJBYXTXQRQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)