Products 1310403-85-0

CAS 1310403-85-0 is the registry number for 1-Phenylpyrrole-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1310403-85-0) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: VNVCVJBYXTXQRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20BNO2
Molecular weight269.1 g/mol
IUPAC name1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole
InChIKeyVNVCVJBYXTXQRQ-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=CN2C3=CC=CC=C3

Computed by PubChem (NCBI)