CAS 1310419-07-8 is the registry number for 3-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole (CAS 1310419-07-8) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole. InChIKey: DNORPNGGHRMZQH-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole |
| InChIKey | DNORPNGGHRMZQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NS2)C |
Computed by PubChem (NCBI)