CAS 2223050-67-5 is the registry number for 5–methyl–4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 2223050-67-5) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: CFRIVYHHIKBCFC-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | CFRIVYHHIKBCFC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=N2)C |
Computed by PubChem (NCBI)