Products 2225179-60-0
CAS 2225179-60-0 is the registry number for 4–(4–Methylpiperidin–1–yl)thiophene–2–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-(4-methylpiperidin-1-yl)thiophen-2-yl]boronic acid (CAS 2225179-60-0) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: [4-(4-methylpiperidin-1-yl)thiophen-2-yl]boronic acid. InChIKey: LVOCQHFGAJZKFQ-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | [4-(4-methylpiperidin-1-yl)thiophen-2-yl]boronic acid |
| InChIKey | LVOCQHFGAJZKFQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CS1)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)