cas: 1671-48-3 — see every product listed under this CAS number, including other names
2-Methyl-5-(methylsulfonyl)aniline (CAS 1671-48-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048008-1G |
| cas | 1671-48-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1065.27 Pln | |
| Fluorochem | 10g | 2002.44 Pln | |
| Fluorochem | 25g | 4267.27 Pln |
| delivery time | 1-2 weeks |
|---|
2-methyl-5-methylsulfonylaniline (CAS 1671-48-3) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 2-methyl-5-methylsulfonylaniline. InChIKey: CVZREHYXQNAPKJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2-methyl-5-methylsulfonylaniline |
| InChIKey | CVZREHYXQNAPKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C)N |
Computed by PubChem (NCBI)