cas: 922718-57-8 — see every product listed under this CAS number, including other names
2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroisoquinoline, 97% (CAS 922718-57-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620762-50MG |
| cas | 922718-57-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline (CAS 922718-57-8) is a chemical compound with the molecular formula C16H24BNO2 and a molecular weight of 273.2 g/mol. IUPAC name: 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline. InChIKey: QRMAQYCEYDOEGC-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO2 |
|---|---|
| Molecular weight | 273.2 g/mol |
| IUPAC name | 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
| InChIKey | QRMAQYCEYDOEGC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CN(CC3)C)C=C2 |
Computed by PubChem (NCBI)