cas: 177080-67-0 — see every product listed under this CAS number, including other names
2-Methyladamantan-2-yl methacrylate 98% (stabilized with MEHQ) (CAS 177080-67-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A296586-5g |
| cas | 177080-67-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 693.00 Pln |
| purity | 98% (stabilized with MEHQ) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A296586 |
(2-methyl-2-adamantyl) 2-methylprop-2-enoate (CAS 177080-67-0) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (2-methyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: FDYDISGSYGFRJM-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (2-methyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1(C2CC3CC(C2)CC1C3)C |
Computed by PubChem (NCBI)