cas: 177080-67-0 — see every product listed under this CAS number, including other names
2-Methyladamantan-2-yl methacrylate (CAS 177080-67-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237894-1G |
| cas | 177080-67-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 25g | 732.05 Pln |
| delivery time | 3-4 weeks |
|---|
(2-methyl-2-adamantyl) 2-methylprop-2-enoate (CAS 177080-67-0) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (2-methyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: FDYDISGSYGFRJM-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (2-methyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1(C2CC3CC(C2)CC1C3)C |
Computed by PubChem (NCBI)