cas: 21640-33-5 — see every product listed under this CAS number, including other names
2-Methylisoquinoline-1,3,4(2H)-trione, 95% (CAS 21640-33-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A194089-1g |
| cas | 21640-33-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 19450.27 Pln | |
| AmBeed | 250mg | 6221.95 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methylisoquinoline-1,3,4-trione (CAS 21640-33-5) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-methylisoquinoline-1,3,4-trione. InChIKey: LSVJISCDJHIYOW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-methylisoquinoline-1,3,4-trione |
| InChIKey | LSVJISCDJHIYOW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)